C15H19BF3NO2 — CID 157034876
5-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-2-(trifluoromethyl)pyridine (PubChem CID 157034876) has the molecular formula C15H19BF3NO2 and a molecular weight of 313.13 g/mol. Its IUPAC name is 5-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-2-(trifluoromethyl)pyridine.
| Compound Name | 5-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-2-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 157034876 |
| Molecular Formula | C15H19BF3NO2 |
| Molecular Weight | 313.13 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-[(1S,2S)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropyl]-2-(trifluoromethyl)pyridine |
| SMILES | CC1(C)OB([C@H]2C[C@@H]2c2ccc(C(F)(F)F)nc2)OC1(C)C |
| InChI | InChI=1S/C15H19BF3NO2/c1-13(2)14(3,4)22-16(21-13)11-7-10(11)9-5-6-12(20-8-9)15(17,18)19/h5-6,8,10-11H,7H2,1-4H3/t10-,11+/m1/s1 |
| InChIKey | YFXLLUIAQOTMTM-MNOVXSKESA-N |
| XLogP | 4.05 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.13 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|