C16H20BF3O3 — CID 176660363
4,4,5,5-tetramethyl-2-[(1S)-2-[3-(trifluoromethoxy)phenyl]cyclopropyl]-1,3,2-dioxaborolane (PubChem CID 176660363) has the molecular formula C16H20BF3O3 and a molecular weight of 328.14 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(1S)-2-[3-(trifluoromethoxy)phenyl]cyclopropyl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(1S)-2-[3-(trifluoromethoxy)phenyl]cyclopropyl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 176660363 |
| Molecular Formula | C16H20BF3O3 |
| Molecular Weight | 328.14 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(1S)-2-[3-(trifluoromethoxy)phenyl]cyclopropyl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB([C@H]2CC2c2cccc(OC(F)(F)F)c2)OC1(C)C |
| InChI | InChI=1S/C16H20BF3O3/c1-14(2)15(3,4)23-17(22-14)13-9-12(13)10-6-5-7-11(8-10)21-16(18,19)20/h5-8,12-13H,9H2,1-4H3/t12?,13-/m0/s1 |
| InChIKey | WALOOMFHKQEBAA-ABLWVSNPSA-N |
| XLogP | 4.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.14 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|