C11H21N3O — CID 157036986
N-(5-ethenylimino-4-methyliminopentyl)propanamide;molecular hydrogen (PubChem CID 157036986) has the molecular formula C11H21N3O and a molecular weight of 211.31 g/mol. Its IUPAC name is N-(5-ethenylimino-4-methyliminopentyl)propanamide;molecular hydrogen.
| Compound Name | N-(5-ethenylimino-4-methyliminopentyl)propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 157036986 |
| Molecular Formula | C11H21N3O |
| Molecular Weight | 211.31 g/mol |
| Exact Mass | 211.17 |
| IUPAC Name | N-(5-ethenylimino-4-methyliminopentyl)propanamide;molecular hydrogen |
| SMILES | C=C/N=C/C(CCCNC(=O)CC)=N\C.[H][H] |
| InChI | InChI=1S/C11H19N3O.H2/c1-4-11(15)14-8-6-7-10(12-3)9-13-5-2;/h5,9H,2,4,6-8H2,1,3H3,(H,14,15);1H/b12-10-,13-9+; |
| InChIKey | FCJUARCOPQOQIS-AGSAXCGISA-N |
| XLogP | 1.82 |
| TPSA | 53.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|