C17H14N4O — CID 157038667
N-benzyl-2-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-5-amine (PubChem CID 157038667) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is N-benzyl-2-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-5-amine.
| Compound Name | N-benzyl-2-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-5-amine |
|---|---|
| PubChem CID | 157038667 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-benzyl-2-(furan-2-yl)pyrazolo[1,5-a]pyrimidin-5-amine |
| SMILES | c1ccc(CNc2ccn3nc(-c4ccco4)cc3n2)cc1 |
| InChI | InChI=1S/C17H14N4O/c1-2-5-13(6-3-1)12-18-16-8-9-21-17(19-16)11-14(20-21)15-7-4-10-22-15/h1-11H,12H2,(H,18,19) |
| InChIKey | ASSJPDHHSKZGJV-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 55.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |