C18H28F3N3O2 — CID 157039506
2-(hydroxymethyl)-1-methylpiperidin-4-ol;2-piperidin-1-yl-6-(trifluoromethyl)pyridine (PubChem CID 157039506) has the molecular formula C18H28F3N3O2 and a molecular weight of 375.44 g/mol. Its IUPAC name is 2-(hydroxymethyl)-1-methylpiperidin-4-ol;2-piperidin-1-yl-6-(trifluoromethyl)pyridine.
| Compound Name | 2-(hydroxymethyl)-1-methylpiperidin-4-ol;2-piperidin-1-yl-6-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 157039506 |
| Molecular Formula | C18H28F3N3O2 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | 2-(hydroxymethyl)-1-methylpiperidin-4-ol;2-piperidin-1-yl-6-(trifluoromethyl)pyridine |
| SMILES | CN1CCC(O)CC1CO.FC(F)(F)c1cccc(N2CCCCC2)n1 |
| InChI | InChI=1S/C11H13F3N2.C7H15NO2/c12-11(13,14)9-5-4-6-10(15-9)16-7-2-1-3-8-16;1-8-3-2-7(10)4-6(8)5-9/h4-6H,1-3,7-8H2;6-7,9-10H,2-5H2,1H3 |
| InChIKey | ZFBXGTFVBBNSNV-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 59.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |