About 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol
3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol (PubChem CID 72878668) has the molecular formula C16H24F3N3O
and a molecular weight of 331.38 g/mol. Its IUPAC name is 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol.
Molecular Properties
| Compound Name | 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol |
| PubChem CID | 72878668 |
| Molecular Formula | C16H24F3N3O |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol |
| SMILES | CN(C)[C@H]1CCN(c2cccc(C(F)(F)F)n2)C[C@H]1CCCO |
| InChI | InChI=1S/C16H24F3N3O/c1-21(2)13-8-9-22(11-12(13)5-4-10-23)15-7-3-6-14(20-15)16(17,18)19/h3,6-7,12-13,23H,4-5,8-11H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | LXDDLLYYIPZVLB-OLZOCXBDSA-N |
| XLogP | 2.63 |
| TPSA | 39.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol?
The IUPAC name of 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol (CID 72878668) is 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol.
What is the SMILES notation for 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol?
The canonical SMILES for 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol is CN(C)[C@H]1CCN(c2cccc(C(F)(F)F)n2)C[C@H]1CCCO.
What is the InChIKey of 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol?
The InChIKey is LXDDLLYYIPZVLB-OLZOCXBDSA-N. The full InChI is InChI=1S/C16H24F3N3O/c1-21(2)13-8-9-22(11-12(13)5-4-10-23)15-7-3-6-14(20-15)16(17,18)19/h3,6-7,12-13,23H,4-5,8-11H2,1-2H3/t12-,13+/m1/s1.
What are the key properties of 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol?
3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol has a molecular weight of 331.38 g/mol, XLogP of 2.63, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3R,4S)-4-(dimethylamino)-1-[6-(trifluoromethyl)-2-pyridinyl]piperidin-3-yl]propan-1-ol is sourced from PubChem (CID 72878668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).