C17H26N2O2 — CID 157044214
ethane;N-[2-(1-methoxyethenyl)-4-(2-methylmorpholin-4-yl)phenyl]methanimine (PubChem CID 157044214) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is ethane;N-[2-(1-methoxyethenyl)-4-(2-methylmorpholin-4-yl)phenyl]methanimine.
| Compound Name | ethane;N-[2-(1-methoxyethenyl)-4-(2-methylmorpholin-4-yl)phenyl]methanimine |
|---|---|
| PubChem CID | 157044214 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | ethane;N-[2-(1-methoxyethenyl)-4-(2-methylmorpholin-4-yl)phenyl]methanimine |
| SMILES | C=Nc1ccc(N2CCOC(C)C2)cc1C(=C)OC.CC |
| InChI | InChI=1S/C15H20N2O2.C2H6/c1-11-10-17(7-8-19-11)13-5-6-15(16-3)14(9-13)12(2)18-4;1-2/h5-6,9,11H,2-3,7-8,10H2,1,4H3;1-2H3 |
| InChIKey | KNOLCTTUWLDJGG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 34.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|