C10H19N3O4 — CID 157044307
2-hydroxy-3-[hydroxy(methyl)amino]-N-methyl-4-(2-oxopyrrolidin-3-yl)butanamide (PubChem CID 157044307) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is 2-hydroxy-3-[hydroxy(methyl)amino]-N-methyl-4-(2-oxopyrrolidin-3-yl)butanamide.
| Compound Name | 2-hydroxy-3-[hydroxy(methyl)amino]-N-methyl-4-(2-oxopyrrolidin-3-yl)butanamide |
|---|---|
| PubChem CID | 157044307 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | 2-hydroxy-3-[hydroxy(methyl)amino]-N-methyl-4-(2-oxopyrrolidin-3-yl)butanamide |
| SMILES | CNC(=O)C(O)C(CC1CCNC1=O)N(C)O |
| InChI | InChI=1S/C10H19N3O4/c1-11-10(16)8(14)7(13(2)17)5-6-3-4-12-9(6)15/h6-8,14,17H,3-5H2,1-2H3,(H,11,16)(H,12,15) |
| InChIKey | IMLPICLMUGJEHA-UHFFFAOYSA-N |
| XLogP | -1.69 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|