C13H21N3O4 — CID 171088245
[(3S)-3-amino-1-(cyclopropylamino)-1-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl] acetate (PubChem CID 171088245) has the molecular formula C13H21N3O4 and a molecular weight of 283.33 g/mol. Its IUPAC name is [(3S)-3-amino-1-(cyclopropylamino)-1-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl] acetate.
| Compound Name | [(3S)-3-amino-1-(cyclopropylamino)-1-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl] acetate |
|---|---|
| PubChem CID | 171088245 |
| Molecular Formula | C13H21N3O4 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.15 |
| IUPAC Name | [(3S)-3-amino-1-(cyclopropylamino)-1-oxo-4-[(3S)-2-oxopyrrolidin-3-yl]butan-2-yl] acetate |
| SMILES | CC(=O)OC(C(=O)NC1CC1)[C@@H](N)C[C@@H]1CCNC1=O |
| InChI | InChI=1S/C13H21N3O4/c1-7(17)20-11(13(19)16-9-2-3-9)10(14)6-8-4-5-15-12(8)18/h8-11H,2-6,14H2,1H3,(H,15,18)(H,16,19)/t8-,10-,11?/m0/s1 |
| InChIKey | LDPZVWCTOJKRTJ-AZXCQMJXSA-N |
| XLogP | -0.95 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | -0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |