C9H16N2O2 — CID 171843230
3-(2-aminobut-3-ynyl)pyrrolidin-2-one;methanol (PubChem CID 171843230) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 3-(2-aminobut-3-ynyl)pyrrolidin-2-one;methanol.
| Compound Name | 3-(2-aminobut-3-ynyl)pyrrolidin-2-one;methanol |
|---|---|
| PubChem CID | 171843230 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 3-(2-aminobut-3-ynyl)pyrrolidin-2-one;methanol |
| SMILES | C#CC(N)CC1CCNC1=O.CO |
| InChI | InChI=1S/C8H12N2O.CH4O/c1-2-7(9)5-6-3-4-10-8(6)11;1-2/h1,6-7H,3-5,9H2,(H,10,11);2H,1H3 |
| InChIKey | OGKXBWXIRHZBKM-UHFFFAOYSA-N |
| XLogP | -0.92 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|