C8H15N3O4S — CID 163323580
(2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanenitrile;methanesulfonic acid (PubChem CID 163323580) has the molecular formula C8H15N3O4S and a molecular weight of 249.29 g/mol. Its IUPAC name is (2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanenitrile;methanesulfonic acid.
| Compound Name | (2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanenitrile;methanesulfonic acid |
|---|---|
| PubChem CID | 163323580 |
| Molecular Formula | C8H15N3O4S |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (2S)-2-amino-3-[(3S)-2-oxopyrrolidin-3-yl]propanenitrile;methanesulfonic acid |
| SMILES | CS(=O)(=O)O.N#C[C@@H](N)C[C@@H]1CCNC1=O |
| InChI | InChI=1S/C7H11N3O.CH4O3S/c8-4-6(9)3-5-1-2-10-7(5)11;1-5(2,3)4/h5-6H,1-3,9H2,(H,10,11);1H3,(H,2,3,4)/t5-,6-;/m0./s1 |
| InChIKey | RPTNWWJOABZSOC-GEMLJDPKSA-N |
| XLogP | -1.13 |
| TPSA | 133.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|