C15H23NO4 — CID 163857556
[(3S)-1-(cyclopropylamino)-3-methyl-1-oxo-4-[(1S)-2-oxocyclopentyl]butan-2-yl] acetate (PubChem CID 163857556) has the molecular formula C15H23NO4 and a molecular weight of 281.35 g/mol. Its IUPAC name is [(3S)-1-(cyclopropylamino)-3-methyl-1-oxo-4-[(1S)-2-oxocyclopentyl]butan-2-yl] acetate.
| Compound Name | [(3S)-1-(cyclopropylamino)-3-methyl-1-oxo-4-[(1S)-2-oxocyclopentyl]butan-2-yl] acetate |
|---|---|
| PubChem CID | 163857556 |
| Molecular Formula | C15H23NO4 |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | [(3S)-1-(cyclopropylamino)-3-methyl-1-oxo-4-[(1S)-2-oxocyclopentyl]butan-2-yl] acetate |
| SMILES | CC(=O)OC(C(=O)NC1CC1)[C@@H](C)C[C@@H]1CCCC1=O |
| InChI | InChI=1S/C15H23NO4/c1-9(8-11-4-3-5-13(11)18)14(20-10(2)17)15(19)16-12-6-7-12/h9,11-12,14H,3-8H2,1-2H3,(H,16,19)/t9-,11-,14?/m0/s1 |
| InChIKey | XLLYDLXCDFWCTB-PEVUIOCQSA-N |
| XLogP | 1.59 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |