About ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate
ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate (PubChem CID 160583363) has the molecular formula C24H42O6
and a molecular weight of 426.59 g/mol. Its IUPAC name is ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate.
Molecular Properties
| Compound Name | ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate |
| PubChem CID | 160583363 |
| Molecular Formula | C24H42O6 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.30 |
| IUPAC Name | ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate |
| SMILES | C.CCOC(=O)C(C)CC1CCCCC1=O.COC(=O)C(C)CC1CCCCC1=O |
| InChI | InChI=1S/C12H20O3.C11H18O3.CH4/c1-3-15-12(14)9(2)8-10-6-4-5-7-11(10)13;1-8(11(13)14-2)7-9-5-3-4-6-10(9)12;/h9-10H,3-8H2,1-2H3;8-9H,3-7H2,1-2H3;1H4 |
| InChIKey | RCBOQAZBKFEQHH-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate?
The IUPAC name of ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate (CID 160583363) is ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate.
What is the SMILES notation for ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate?
The canonical SMILES for ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate is C.CCOC(=O)C(C)CC1CCCCC1=O.COC(=O)C(C)CC1CCCCC1=O.
What is the InChIKey of ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate?
The InChIKey is RCBOQAZBKFEQHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O3.C11H18O3.CH4/c1-3-15-12(14)9(2)8-10-6-4-5-7-11(10)13;1-8(11(13)14-2)7-9-5-3-4-6-10(9)12;/h9-10H,3-8H2,1-2H3;8-9H,3-7H2,1-2H3;1H4.
What are the key properties of ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate?
ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate has a molecular weight of 426.59 g/mol, XLogP of 4.92, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-methyl-3-(2-oxocyclohexyl)propanoate;methane;methyl 2-methyl-3-(2-oxocyclohexyl)propanoate is sourced from PubChem (CID 160583363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).