C10H15NO2 — CID 163576494
(3S)-2-hydroxy-3-methyl-4-[(1S)-2-oxocyclopentyl]butanenitrile (PubChem CID 163576494) has the molecular formula C10H15NO2 and a molecular weight of 181.23 g/mol. Its IUPAC name is (3S)-2-hydroxy-3-methyl-4-[(1S)-2-oxocyclopentyl]butanenitrile.
| Compound Name | (3S)-2-hydroxy-3-methyl-4-[(1S)-2-oxocyclopentyl]butanenitrile |
|---|---|
| PubChem CID | 163576494 |
| Molecular Formula | C10H15NO2 |
| Molecular Weight | 181.23 g/mol |
| Exact Mass | 181.11 |
| IUPAC Name | (3S)-2-hydroxy-3-methyl-4-[(1S)-2-oxocyclopentyl]butanenitrile |
| SMILES | C[C@@H](C[C@@H]1CCCC1=O)C(O)C#N |
| InChI | InChI=1S/C10H15NO2/c1-7(10(13)6-11)5-8-3-2-4-9(8)12/h7-8,10,13H,2-5H2,1H3/t7-,8-,10?/m0/s1 |
| InChIKey | RCWKJMSXKCYPNX-JIBHNJPVSA-N |
| XLogP | 1.27 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.23 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanohydrins', 'substructure': 'N/A'} |
|---|