C30H23B3FN7O5 — CID 157047055
CID 157047055 (PubChem CID 157047055) has the molecular formula C30H23B3FN7O5 and a molecular weight of 612.99 g/mol.
| Compound Name | CID 157047055 |
|---|---|
| PubChem CID | 157047055 |
| Molecular Formula | C30H23B3FN7O5 |
| Molecular Weight | 612.99 g/mol |
| Exact Mass | 613.20 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Oc1ccc(-n2ccc(Oc3ccc(Nc4ncnc5cc(OC)c(OC6CN(C(=O)C=C)C6)cc45)c(F)c3)n2)cn1 |
| InChI | InChI=1S/C30H23B3FN7O5/c1-3-28(42)40-14-19(15-40)44-25-11-20-23(12-24(25)43-2)36-16-37-29(20)38-22-6-5-18(10-21(22)34)45-27-8-9-41(39-27)17-4-7-26(35-13-17)46-30(31,32)33/h3-13,16,19H,1,14-15H2,2H3,(H,36,37,38) |
| InChIKey | WKZPXWFCPUFWJM-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 125.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.99 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|