C31H31B3FN7O5 — CID 174035944
CID 174035944 (PubChem CID 174035944) has the molecular formula C31H31B3FN7O5 and a molecular weight of 633.07 g/mol.
| Compound Name | CID 174035944 |
|---|---|
| PubChem CID | 174035944 |
| Molecular Formula | C31H31B3FN7O5 |
| Molecular Weight | 633.07 g/mol |
| Exact Mass | 633.26 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Oc1cc2ncnc(Nc3ccc(Oc4ccn(C(=O)NC(C)(C)C)n4)cc3F)c2cc1OC1CCN(C(=O)C=C)CC1 |
| InChI | InChI=1S/C31H31B3FN7O5/c1-5-27(43)41-11-8-18(9-12-41)45-24-15-20-23(16-25(24)47-31(32,33)34)36-17-37-28(20)38-22-7-6-19(14-21(22)35)46-26-10-13-42(40-26)29(44)39-30(2,3)4/h5-7,10,13-18H,1,8-9,11-12H2,2-4H3,(H,39,44)(H,36,37,38) |
| InChIKey | LTKKPKNTKYLRRI-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.07 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|