About ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten
ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten (PubChem CID 157048732) has the molecular formula C13H29N2OW-
and a molecular weight of 413.23 g/mol. Its IUPAC name is ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten.
Molecular Properties
| Compound Name | ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten |
| PubChem CID | 157048732 |
| Molecular Formula | C13H29N2OW- |
| Molecular Weight | 413.23 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten |
| SMILES | CC.CCN1CCC(COCCC[NH-])CC1.[W] |
| InChI | InChI=1S/C11H23N2O.C2H6.W/c1-2-13-7-4-11(5-8-13)10-14-9-3-6-12;1-2;/h11-12H,2-10H2,1H3;1-2H3;/q-1;; |
| InChIKey | IISGGPQRKYELJF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 36.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 413.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten?
The IUPAC name of ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten (CID 157048732) is ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten.
What is the SMILES notation for ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten?
The canonical SMILES for ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten is CC.CCN1CCC(COCCC[NH-])CC1.[W].
What is the InChIKey of ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten?
The InChIKey is IISGGPQRKYELJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N2O.C2H6.W/c1-2-13-7-4-11(5-8-13)10-14-9-3-6-12;1-2;/h11-12H,2-10H2,1H3;1-2H3;/q-1;;.
What are the key properties of ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten?
ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten has a molecular weight of 413.23 g/mol, XLogP of 3.20, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-[(1-ethylpiperidin-4-yl)methoxy]propylazanide;tungsten is sourced from PubChem (CID 157048732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).