C13H22N4O6S — CID 157048749
2-[[2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]propanoyl]amino]acetyl]amino]acetic acid (PubChem CID 157048749) has the molecular formula C13H22N4O6S and a molecular weight of 362.41 g/mol. Its IUPAC name is 2-[[2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]propanoyl]amino]acetyl]amino]acetic acid.
| Compound Name | 2-[[2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]propanoyl]amino]acetyl]amino]acetic acid |
|---|---|
| PubChem CID | 157048749 |
| Molecular Formula | C13H22N4O6S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[[2-[[(2S)-2-[[(2S)-2-formamido-4-methylsulfanylbutanoyl]amino]propanoyl]amino]acetyl]amino]acetic acid |
| SMILES | CSCC[C@H](NC=O)C(=O)N[C@@H](C)C(=O)NCC(=O)NCC(=O)O |
| InChI | InChI=1S/C13H22N4O6S/c1-8(12(22)15-5-10(19)14-6-11(20)21)17-13(23)9(16-7-18)3-4-24-2/h7-9H,3-6H2,1-2H3,(H,14,19)(H,15,22)(H,16,18)(H,17,23)(H,20,21)/t8-,9-/m0/s1 |
| InChIKey | JTYCNLZSYLCXRI-IUCAKERBSA-N |
| XLogP | -2.32 |
| TPSA | 153.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | -2.32 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|