C22H30N2O10 — CID 157051826
diethyl oxalate;ethyl 4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]-2,4-dioxobutanoate (PubChem CID 157051826) has the molecular formula C22H30N2O10 and a molecular weight of 482.49 g/mol. Its IUPAC name is diethyl oxalate;ethyl 4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]-2,4-dioxobutanoate.
| Compound Name | diethyl oxalate;ethyl 4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 157051826 |
| Molecular Formula | C22H30N2O10 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | diethyl oxalate;ethyl 4-[5-[(2-methylpropan-2-yl)oxycarbonylamino]-2-pyridinyl]-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)CC(=O)c1ccc(NC(=O)OC(C)(C)C)cn1.CCOC(=O)C(=O)OCC |
| InChI | InChI=1S/C16H20N2O6.C6H10O4/c1-5-23-14(21)13(20)8-12(19)11-7-6-10(9-17-11)18-15(22)24-16(2,3)4;1-3-9-5(7)6(8)10-4-2/h6-7,9H,5,8H2,1-4H3,(H,18,22);3-4H2,1-2H3 |
| InChIKey | AAHIKKDFDZODKM-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 164.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|