C18H25N3O7 — CID 69267799
diethyl 2-[[5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carbonyl]amino]propanedioate (PubChem CID 69267799) has the molecular formula C18H25N3O7 and a molecular weight of 395.41 g/mol. Its IUPAC name is diethyl 2-[[5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carbonyl]amino]propanedioate.
| Compound Name | diethyl 2-[[5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carbonyl]amino]propanedioate |
|---|---|
| PubChem CID | 69267799 |
| Molecular Formula | C18H25N3O7 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | diethyl 2-[[5-[(2-methylpropan-2-yl)oxycarbonylamino]pyridine-2-carbonyl]amino]propanedioate |
| SMILES | CCOC(=O)C(NC(=O)c1ccc(NC(=O)OC(C)(C)C)cn1)C(=O)OCC |
| InChI | InChI=1S/C18H25N3O7/c1-6-26-15(23)13(16(24)27-7-2)21-14(22)12-9-8-11(10-19-12)20-17(25)28-18(3,4)5/h8-10,13H,6-7H2,1-5H3,(H,20,25)(H,21,22) |
| InChIKey | FSCPDQXCILDRCY-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 132.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|