C36H54F3N3O5 — CID 157054144
5-butyl-3-(cyclohexylmethyl)-9-[1-(2,4,6-trimethylbenzoyl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 157054144) has the molecular formula C36H54F3N3O5 and a molecular weight of 665.84 g/mol. Its IUPAC name is 5-butyl-3-(cyclohexylmethyl)-9-[1-(2,4,6-trimethylbenzoyl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-butyl-3-(cyclohexylmethyl)-9-[1-(2,4,6-trimethylbenzoyl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 157054144 |
| Molecular Formula | C36H54F3N3O5 |
| Molecular Weight | 665.84 g/mol |
| Exact Mass | 665.40 |
| IUPAC Name | 5-butyl-3-(cyclohexylmethyl)-9-[1-(2,4,6-trimethylbenzoyl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CCCCC1CN(CC2CCCCC2)C(=O)OC12CCN(C1CCN(C(=O)c3c(C)cc(C)cc3C)CC1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C34H53N3O3.C2HF3O2/c1-5-6-12-29-24-37(23-28-10-8-7-9-11-28)33(39)40-34(29)15-19-35(20-16-34)30-13-17-36(18-14-30)32(38)31-26(3)21-25(2)22-27(31)4;3-2(4,5)1(6)7/h21-22,28-30H,5-20,23-24H2,1-4H3;(H,6,7) |
| InChIKey | AANYUFJTOYVATF-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.84 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |