C32H49F3N4O6 — CID 161264244
5-butyl-3-(cyclohexylmethyl)-9-[1-(3,5-dimethyl-1,2-oxazole-4-carbonyl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid (PubChem CID 161264244) has the molecular formula C32H49F3N4O6 and a molecular weight of 642.76 g/mol. Its IUPAC name is 5-butyl-3-(cyclohexylmethyl)-9-[1-(3,5-dimethyl-1,2-oxazole-4-carbonyl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid.
| Compound Name | 5-butyl-3-(cyclohexylmethyl)-9-[1-(3,5-dimethyl-1,2-oxazole-4-carbonyl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 161264244 |
| Molecular Formula | C32H49F3N4O6 |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.36 |
| IUPAC Name | 5-butyl-3-(cyclohexylmethyl)-9-[1-(3,5-dimethyl-1,2-oxazole-4-carbonyl)piperidin-4-yl]-1-oxa-3,9-diazaspiro[5.5]undecan-2-one;2,2,2-trifluoroacetic acid |
| SMILES | CCCCC1CN(CC2CCCCC2)C(=O)OC12CCN(C1CCN(C(=O)c3c(C)noc3C)CC1)CC2.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C30H48N4O4.C2HF3O2/c1-4-5-11-25-21-34(20-24-9-7-6-8-10-24)29(36)37-30(25)14-18-32(19-15-30)26-12-16-33(17-13-26)28(35)27-22(2)31-38-23(27)3;3-2(4,5)1(6)7/h24-26H,4-21H2,1-3H3;(H,6,7) |
| InChIKey | VCYQBGKJTYTYSO-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 116.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |