C32H19BrCl4N4S — CID 157056041
5-bromo-2-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;2-[(2,6-dichlorophenyl)-isocyanomethyl]-5-phenylsulfanylpyridine (PubChem CID 157056041) has the molecular formula C32H19BrCl4N4S and a molecular weight of 713.32 g/mol. Its IUPAC name is 5-bromo-2-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;2-[(2,6-dichlorophenyl)-isocyanomethyl]-5-phenylsulfanylpyridine.
| Compound Name | 5-bromo-2-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;2-[(2,6-dichlorophenyl)-isocyanomethyl]-5-phenylsulfanylpyridine |
|---|---|
| PubChem CID | 157056041 |
| Molecular Formula | C32H19BrCl4N4S |
| Molecular Weight | 713.32 g/mol |
| Exact Mass | 709.93 |
| IUPAC Name | 5-bromo-2-[(2,6-dichlorophenyl)-isocyanomethyl]pyridine;2-[(2,6-dichlorophenyl)-isocyanomethyl]-5-phenylsulfanylpyridine |
| SMILES | [C-]#[N+]C(c1ccc(Br)cn1)c1c(Cl)cccc1Cl.[C-]#[N+]C(c1ccc(Sc2ccccc2)cn1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H12Cl2N2S.C13H7BrCl2N2/c1-22-19(18-15(20)8-5-9-16(18)21)17-11-10-14(12-23-17)24-13-6-3-2-4-7-13;1-17-13(11-6-5-8(14)7-18-11)12-9(15)3-2-4-10(12)16/h2-12,19H;2-7,13H |
| InChIKey | AATOJFAXICOONJ-UHFFFAOYSA-N |
| XLogP | 11.71 |
| TPSA | 34.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.32 |
| LogP ≤ 5 | 11.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|