C24H17BrCl4N4 — CID 167543059
2-bromopyridine;2,6-dichlorobenzonitrile;(2,6-dichlorophenyl)-pyridin-2-ylmethanamine (PubChem CID 167543059) has the molecular formula C24H17BrCl4N4 and a molecular weight of 583.14 g/mol. Its IUPAC name is 2-bromopyridine;2,6-dichlorobenzonitrile;(2,6-dichlorophenyl)-pyridin-2-ylmethanamine.
| Compound Name | 2-bromopyridine;2,6-dichlorobenzonitrile;(2,6-dichlorophenyl)-pyridin-2-ylmethanamine |
|---|---|
| PubChem CID | 167543059 |
| Molecular Formula | C24H17BrCl4N4 |
| Molecular Weight | 583.14 g/mol |
| Exact Mass | 579.94 |
| IUPAC Name | 2-bromopyridine;2,6-dichlorobenzonitrile;(2,6-dichlorophenyl)-pyridin-2-ylmethanamine |
| SMILES | Brc1ccccn1.N#Cc1c(Cl)cccc1Cl.NC(c1ccccn1)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H10Cl2N2.C7H3Cl2N.C5H4BrN/c13-8-4-3-5-9(14)11(8)12(15)10-6-1-2-7-16-10;8-6-2-1-3-7(9)5(6)4-10;6-5-3-1-2-4-7-5/h1-7,12H,15H2;1-3H;1-4H |
| InChIKey | BLEUNPAEEOKCIY-UHFFFAOYSA-N |
| XLogP | 8.15 |
| TPSA | 75.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.14 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|