C28H33N5O5 — CID 157058204
ethyl (Z)-2-benzoyl-3-(dimethylamino)prop-2-enoate;ethyl 4-phenylpyrimidine-5-carboxylate;methanimidamide (PubChem CID 157058204) has the molecular formula C28H33N5O5 and a molecular weight of 519.60 g/mol. Its IUPAC name is ethyl (Z)-2-benzoyl-3-(dimethylamino)prop-2-enoate;ethyl 4-phenylpyrimidine-5-carboxylate;methanimidamide.
| Compound Name | ethyl (Z)-2-benzoyl-3-(dimethylamino)prop-2-enoate;ethyl 4-phenylpyrimidine-5-carboxylate;methanimidamide |
|---|---|
| PubChem CID | 157058204 |
| Molecular Formula | C28H33N5O5 |
| Molecular Weight | 519.60 g/mol |
| Exact Mass | 519.25 |
| IUPAC Name | ethyl (Z)-2-benzoyl-3-(dimethylamino)prop-2-enoate;ethyl 4-phenylpyrimidine-5-carboxylate;methanimidamide |
| SMILES | CCOC(=O)/C(=C\N(C)C)C(=O)c1ccccc1.CCOC(=O)c1cncnc1-c1ccccc1.[H]/N=C/N |
| InChI | InChI=1S/C14H17NO3.C13H12N2O2.CH4N2/c1-4-18-14(17)12(10-15(2)3)13(16)11-8-6-5-7-9-11;1-2-17-13(16)11-8-14-9-15-12(11)10-6-4-3-5-7-10;2-1-3/h5-10H,4H2,1-3H3;3-9H,2H2,1H3;1H,(H3,2,3)/b12-10-;; |
| InChIKey | AAZTZJGNABSFNR-VSXCOVETSA-N |
| XLogP | 3.75 |
| TPSA | 148.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.60 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|