About N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid
N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid (PubChem CID 157062649) has the molecular formula C11H24B2N4O2
and a molecular weight of 265.96 g/mol. Its IUPAC name is N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid.
Molecular Properties
| Compound Name | N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid |
| PubChem CID | 157062649 |
| Molecular Formula | C11H24B2N4O2 |
| Molecular Weight | 265.96 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid |
| SMILES | CB(O)NCN.CB(O)NCNCc1ccccc1 |
| InChI | InChI=1S/C9H15BN2O.C2H9BN2O/c1-10(13)12-8-11-7-9-5-3-2-4-6-9;1-3(6)5-2-4/h2-6,11-13H,7-8H2,1H3;5-6H,2,4H2,1H3 |
| InChIKey | ABMURLOKHJAMGF-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 265.96 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid?
The IUPAC name of N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid (CID 157062649) is N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid.
What is the SMILES notation for N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid?
The canonical SMILES for N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid is CB(O)NCN.CB(O)NCNCc1ccccc1.
What is the InChIKey of N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid?
The InChIKey is ABMURLOKHJAMGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15BN2O.C2H9BN2O/c1-10(13)12-8-11-7-9-5-3-2-4-6-9;1-3(6)5-2-4/h2-6,11-13H,7-8H2,1H3;5-6H,2,4H2,1H3.
What are the key properties of N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid?
N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid has a molecular weight of 265.96 g/mol, XLogP of -0.96, 7 rotatable bonds, 6 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(aminomethyl)-methylboronamidic acid;N-[(benzylamino)methyl]-methylboronamidic acid is sourced from PubChem (CID 157062649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).