C22H29NO4 — CID 157064846
(2R)-1-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]-3-morpholin-4-ylpropan-2-ol (PubChem CID 157064846) has the molecular formula C22H29NO4 and a molecular weight of 371.48 g/mol. Its IUPAC name is (2R)-1-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]-3-morpholin-4-ylpropan-2-ol.
| Compound Name | (2R)-1-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
|---|---|
| PubChem CID | 157064846 |
| Molecular Formula | C22H29NO4 |
| Molecular Weight | 371.48 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | (2R)-1-[2-[2-(4-methoxyphenyl)ethyl]phenoxy]-3-morpholin-4-ylpropan-2-ol |
| SMILES | COc1ccc(CCc2ccccc2OC[C@H](O)CN2CCOCC2)cc1 |
| InChI | InChI=1S/C22H29NO4/c1-25-21-10-7-18(8-11-21)6-9-19-4-2-3-5-22(19)27-17-20(24)16-23-12-14-26-15-13-23/h2-5,7-8,10-11,20,24H,6,9,12-17H2,1H3/t20-/m1/s1 |
| InChIKey | GAJVIANSKWARKM-HXUWFJFHSA-N |
| XLogP | 2.55 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.48 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |