About 3-ethyl-1,5-dimethoxypentane
3-ethyl-1,5-dimethoxypentane (PubChem CID 15706809) has the molecular formula C9H20O2
and a molecular weight of 160.26 g/mol. Its IUPAC name is 3-ethyl-1,5-dimethoxypentane.
Molecular Properties
| Compound Name | 3-ethyl-1,5-dimethoxypentane |
| PubChem CID | 15706809 |
| Molecular Formula | C9H20O2 |
| Molecular Weight | 160.26 g/mol |
| Exact Mass | 160.15 |
| IUPAC Name | 3-ethyl-1,5-dimethoxypentane |
| SMILES | CCC(CCOC)CCOC |
| InChI | InChI=1S/C9H20O2/c1-4-9(5-7-10-2)6-8-11-3/h9H,4-8H2,1-3H3 |
| InChIKey | VTDBLHFUJYYXQW-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-1,5-dimethoxypentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,5-dimethoxypentane?
The IUPAC name of 3-ethyl-1,5-dimethoxypentane (CID 15706809) is 3-ethyl-1,5-dimethoxypentane.
What is the SMILES notation for 3-ethyl-1,5-dimethoxypentane?
The canonical SMILES for 3-ethyl-1,5-dimethoxypentane is CCC(CCOC)CCOC.
What is the InChIKey of 3-ethyl-1,5-dimethoxypentane?
The InChIKey is VTDBLHFUJYYXQW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20O2/c1-4-9(5-7-10-2)6-8-11-3/h9H,4-8H2,1-3H3.
What are the key properties of 3-ethyl-1,5-dimethoxypentane?
3-ethyl-1,5-dimethoxypentane has a molecular weight of 160.26 g/mol, XLogP of 2.09, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,5-dimethoxypentane is sourced from PubChem (CID 15706809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).