C29H30N6O2 — CID 157073831
3-[4-[4-amino-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-(2-methylphenyl)propan-1-one (PubChem CID 157073831) has the molecular formula C29H30N6O2 and a molecular weight of 494.60 g/mol. Its IUPAC name is 3-[4-[4-amino-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-(2-methylphenyl)propan-1-one.
| Compound Name | 3-[4-[4-amino-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-(2-methylphenyl)propan-1-one |
|---|---|
| PubChem CID | 157073831 |
| Molecular Formula | C29H30N6O2 |
| Molecular Weight | 494.60 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 3-[4-[4-amino-1-[(3R)-1-prop-2-enoylpiperidin-3-yl]pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-(2-methylphenyl)propan-1-one |
| SMILES | C=CC(=O)N1CCC[C@@H](n2nc(-c3ccc(CCC(=O)c4ccccc4C)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C29H30N6O2/c1-3-25(37)34-16-6-8-22(17-34)35-29-26(28(30)31-18-32-29)27(33-35)21-13-10-20(11-14-21)12-15-24(36)23-9-5-4-7-19(23)2/h3-5,7,9-11,13-14,18,22H,1,6,8,12,15-17H2,2H3,(H2,30,31,32)/t22-/m1/s1 |
| InChIKey | XYLQVBAKFWEUNG-JOCHJYFZSA-N |
| XLogP | 4.55 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.60 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|