C28H26F2N6O2 — CID 157147462
3-[4-[4-amino-1-(1-prop-2-enoylpiperidin-3-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-(2,5-difluorophenyl)propan-1-one (PubChem CID 157147462) has the molecular formula C28H26F2N6O2 and a molecular weight of 516.55 g/mol. Its IUPAC name is 3-[4-[4-amino-1-(1-prop-2-enoylpiperidin-3-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-(2,5-difluorophenyl)propan-1-one.
| Compound Name | 3-[4-[4-amino-1-(1-prop-2-enoylpiperidin-3-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-(2,5-difluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 157147462 |
| Molecular Formula | C28H26F2N6O2 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 3-[4-[4-amino-1-(1-prop-2-enoylpiperidin-3-yl)pyrazolo[3,4-d]pyrimidin-3-yl]phenyl]-1-(2,5-difluorophenyl)propan-1-one |
| SMILES | C=CC(=O)N1CCCC(n2nc(-c3ccc(CCC(=O)c4cc(F)ccc4F)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C28H26F2N6O2/c1-2-24(38)35-13-3-4-20(15-35)36-28-25(27(31)32-16-33-28)26(34-36)18-8-5-17(6-9-18)7-12-23(37)21-14-19(29)10-11-22(21)30/h2,5-6,8-11,14,16,20H,1,3-4,7,12-13,15H2,(H2,31,32,33) |
| InChIKey | AAPFTMKQAMQYGU-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|