C26H23F2N7O — CID 158776227
3-[4-amino-3-[4-[3-(2,5-difluorophenyl)-3-oxopropyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonitrile (PubChem CID 158776227) has the molecular formula C26H23F2N7O and a molecular weight of 487.51 g/mol. Its IUPAC name is 3-[4-amino-3-[4-[3-(2,5-difluorophenyl)-3-oxopropyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonitrile.
| Compound Name | 3-[4-amino-3-[4-[3-(2,5-difluorophenyl)-3-oxopropyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonitrile |
|---|---|
| PubChem CID | 158776227 |
| Molecular Formula | C26H23F2N7O |
| Molecular Weight | 487.51 g/mol |
| Exact Mass | 487.19 |
| IUPAC Name | 3-[4-amino-3-[4-[3-(2,5-difluorophenyl)-3-oxopropyl]phenyl]pyrazolo[3,4-d]pyrimidin-1-yl]piperidine-1-carbonitrile |
| SMILES | N#CN1CCCC(n2nc(-c3ccc(CCC(=O)c4cc(F)ccc4F)cc3)c3c(N)ncnc32)C1 |
| InChI | InChI=1S/C26H23F2N7O/c27-18-8-9-21(28)20(12-18)22(36)10-5-16-3-6-17(7-4-16)24-23-25(30)31-15-32-26(23)35(33-24)19-2-1-11-34(13-19)14-29/h3-4,6-9,12,15,19H,1-2,5,10-11,13H2,(H2,30,31,32) |
| InChIKey | WFWZVBCQUQSLTB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 113.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.51 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|