About ethyl-methoxy-dipentoxysilane;ethylsilane
ethyl-methoxy-dipentoxysilane;ethylsilane (PubChem CID 157076319) has the molecular formula C15H38O3Si2
and a molecular weight of 322.64 g/mol. Its IUPAC name is ethyl-methoxy-dipentoxysilane;ethylsilane.
Molecular Properties
| Compound Name | ethyl-methoxy-dipentoxysilane;ethylsilane |
| PubChem CID | 157076319 |
| Molecular Formula | C15H38O3Si2 |
| Molecular Weight | 322.64 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | ethyl-methoxy-dipentoxysilane;ethylsilane |
| SMILES | CCCCCO[Si](CC)(OC)OCCCCC.CC[SiH3] |
| InChI | InChI=1S/C13H30O3Si.C2H8Si/c1-5-8-10-12-15-17(7-3,14-4)16-13-11-9-6-2;1-2-3/h5-13H2,1-4H3;2H2,1,3H3 |
| InChIKey | ACZYLHFOZWHYTM-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.64 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl-methoxy-dipentoxysilane;ethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl-methoxy-dipentoxysilane;ethylsilane?
The IUPAC name of ethyl-methoxy-dipentoxysilane;ethylsilane (CID 157076319) is ethyl-methoxy-dipentoxysilane;ethylsilane.
What is the SMILES notation for ethyl-methoxy-dipentoxysilane;ethylsilane?
The canonical SMILES for ethyl-methoxy-dipentoxysilane;ethylsilane is CCCCCO[Si](CC)(OC)OCCCCC.CC[SiH3].
What is the InChIKey of ethyl-methoxy-dipentoxysilane;ethylsilane?
The InChIKey is ACZYLHFOZWHYTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30O3Si.C2H8Si/c1-5-8-10-12-15-17(7-3,14-4)16-13-11-9-6-2;1-2-3/h5-13H2,1-4H3;2H2,1,3H3.
What are the key properties of ethyl-methoxy-dipentoxysilane;ethylsilane?
ethyl-methoxy-dipentoxysilane;ethylsilane has a molecular weight of 322.64 g/mol, XLogP of 3.80, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl-methoxy-dipentoxysilane;ethylsilane is sourced from PubChem (CID 157076319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).