C62H52F12N8O6 — CID 157078219
5-[2-[(2R)-1-(3,5-difluorophenyl)-5-[5-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 157078219) has the molecular formula C62H52F12N8O6 and a molecular weight of 1233.12 g/mol. Its IUPAC name is 5-[2-[(2R)-1-(3,5-difluorophenyl)-5-[5-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(2R)-1-(3,5-difluorophenyl)-5-[5-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 157078219 |
| Molecular Formula | C62H52F12N8O6 |
| Molecular Weight | 1233.12 g/mol |
| Exact Mass | 1232.38 |
| IUPAC Name | 5-[2-[(2R)-1-(3,5-difluorophenyl)-5-[5-hydroxy-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-1-yl]-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | NC(=O)c1cc(-c2cccnc2[C@@H](CC(=O)Cn2nc(C(F)(F)F)c3c2CCC(O)C3)Cc2cc(F)cc(F)c2)ccc1F.NC(=O)c1cc(-c2cccnc2[C@@H](CC(=O)Cn2nc(C(F)(F)F)c3c2CCC(O)C3)Cc2cc(F)cc(F)c2)ccc1F |
| InChI | InChI=1S/2C31H26F6N4O3/c2*32-19-9-16(10-20(33)13-19)8-18(28-23(2-1-7-39-28)17-3-5-26(34)24(12-17)30(38)44)11-22(43)15-41-27-6-4-21(42)14-25(27)29(40-41)31(35,36)37/h2*1-3,5,7,9-10,12-13,18,21,42H,4,6,8,11,14-15H2,(H2,38,44)/t2*18-,21?/m11/s1 |
| InChIKey | ADFOETBCWXLTIE-OHQXNRIASA-N |
| XLogP | 10.63 |
| TPSA | 222.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 88 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1233.12 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |