C16H19FN4O2 — CID 157083674
ethyl N-[2-amino-3-fluoro-4-[(5-methyl-2-pyridinyl)methylamino]phenyl]carbamate (PubChem CID 157083674) has the molecular formula C16H19FN4O2 and a molecular weight of 318.35 g/mol. Its IUPAC name is ethyl N-[2-amino-3-fluoro-4-[(5-methyl-2-pyridinyl)methylamino]phenyl]carbamate.
| Compound Name | ethyl N-[2-amino-3-fluoro-4-[(5-methyl-2-pyridinyl)methylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 157083674 |
| Molecular Formula | C16H19FN4O2 |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.15 |
| IUPAC Name | ethyl N-[2-amino-3-fluoro-4-[(5-methyl-2-pyridinyl)methylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1ccc(NCc2ccc(C)cn2)c(F)c1N |
| InChI | InChI=1S/C16H19FN4O2/c1-3-23-16(22)21-13-7-6-12(14(17)15(13)18)20-9-11-5-4-10(2)8-19-11/h4-8,20H,3,9,18H2,1-2H3,(H,21,22) |
| InChIKey | ADVNSRSUYJIUKP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|