C14H17BrN2O9S2 — CID 157084038
3-bromo-2-oxopropanoic acid;2-ethoxycarbonyl-1,3-thiazole-4-carboxylic acid;ethyl 2-amino-2-sulfanylideneacetate (PubChem CID 157084038) has the molecular formula C14H17BrN2O9S2 and a molecular weight of 501.33 g/mol. Its IUPAC name is 3-bromo-2-oxopropanoic acid;2-ethoxycarbonyl-1,3-thiazole-4-carboxylic acid;ethyl 2-amino-2-sulfanylideneacetate.
| Compound Name | 3-bromo-2-oxopropanoic acid;2-ethoxycarbonyl-1,3-thiazole-4-carboxylic acid;ethyl 2-amino-2-sulfanylideneacetate |
|---|---|
| PubChem CID | 157084038 |
| Molecular Formula | C14H17BrN2O9S2 |
| Molecular Weight | 501.33 g/mol |
| Exact Mass | 499.96 |
| IUPAC Name | 3-bromo-2-oxopropanoic acid;2-ethoxycarbonyl-1,3-thiazole-4-carboxylic acid;ethyl 2-amino-2-sulfanylideneacetate |
| SMILES | CCOC(=O)C(N)=S.CCOC(=O)c1nc(C(=O)O)cs1.O=C(O)C(=O)CBr |
| InChI | InChI=1S/C7H7NO4S.C4H7NO2S.C3H3BrO3/c1-2-12-7(11)5-8-4(3-13-5)6(9)10;1-2-7-4(6)3(5)8;4-1-2(5)3(6)7/h3H,2H2,1H3,(H,9,10);2H2,1H3,(H2,5,8);1H2,(H,6,7) |
| InChIKey | ADWPGHLWPXSZGH-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 183.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.33 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|