C9H13N3O4S2 — CID 159977123
ethyl 2-amino-2-sulfanylideneacetate;ethyl 1,2,4-thiadiazole-5-carboxylate (PubChem CID 159977123) has the molecular formula C9H13N3O4S2 and a molecular weight of 291.35 g/mol. Its IUPAC name is ethyl 2-amino-2-sulfanylideneacetate;ethyl 1,2,4-thiadiazole-5-carboxylate.
| Compound Name | ethyl 2-amino-2-sulfanylideneacetate;ethyl 1,2,4-thiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 159977123 |
| Molecular Formula | C9H13N3O4S2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | ethyl 2-amino-2-sulfanylideneacetate;ethyl 1,2,4-thiadiazole-5-carboxylate |
| SMILES | CCOC(=O)C(N)=S.CCOC(=O)c1ncns1 |
| InChI | InChI=1S/C5H6N2O2S.C4H7NO2S/c1-2-9-5(8)4-6-3-7-10-4;1-2-7-4(6)3(5)8/h3H,2H2,1H3;2H2,1H3,(H2,5,8) |
| InChIKey | OFHJCMYWLRORAG-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 104.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|