C29H52O4S — CID 157085593
4-ethenyl-4-propan-2-yloxane;3-ethenyl-3-propan-2-yloxolane;4-ethenyl-4-propan-2-ylthiane 1,1-dioxide (PubChem CID 157085593) has the molecular formula C29H52O4S and a molecular weight of 496.80 g/mol. Its IUPAC name is 4-ethenyl-4-propan-2-yloxane;3-ethenyl-3-propan-2-yloxolane;4-ethenyl-4-propan-2-ylthiane 1,1-dioxide.
| Compound Name | 4-ethenyl-4-propan-2-yloxane;3-ethenyl-3-propan-2-yloxolane;4-ethenyl-4-propan-2-ylthiane 1,1-dioxide |
|---|---|
| PubChem CID | 157085593 |
| Molecular Formula | C29H52O4S |
| Molecular Weight | 496.80 g/mol |
| Exact Mass | 496.36 |
| IUPAC Name | 4-ethenyl-4-propan-2-yloxane;3-ethenyl-3-propan-2-yloxolane;4-ethenyl-4-propan-2-ylthiane 1,1-dioxide |
| SMILES | C=CC1(C(C)C)CCOC1.C=CC1(C(C)C)CCOCC1.C=CC1(C(C)C)CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C10H18O2S.C10H18O.C9H16O/c1-4-10(9(2)3)5-7-13(11,12)8-6-10;1-4-10(9(2)3)5-7-11-8-6-10;1-4-9(8(2)3)5-6-10-7-9/h4,9H,1,5-8H2,2-3H3;4,9H,1,5-8H2,2-3H3;4,8H,1,5-7H2,2-3H3 |
| InChIKey | AEAWYNPZZGYLJK-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.80 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|