C26H52O4S — CID 159218360
4-tert-butyloxane;3-tert-butyloxolane;4-tert-butylthiane 1,1-dioxide (PubChem CID 159218360) has the molecular formula C26H52O4S and a molecular weight of 460.77 g/mol. Its IUPAC name is 4-tert-butyloxane;3-tert-butyloxolane;4-tert-butylthiane 1,1-dioxide.
| Compound Name | 4-tert-butyloxane;3-tert-butyloxolane;4-tert-butylthiane 1,1-dioxide |
|---|---|
| PubChem CID | 159218360 |
| Molecular Formula | C26H52O4S |
| Molecular Weight | 460.77 g/mol |
| Exact Mass | 460.36 |
| IUPAC Name | 4-tert-butyloxane;3-tert-butyloxolane;4-tert-butylthiane 1,1-dioxide |
| SMILES | CC(C)(C)C1CCOC1.CC(C)(C)C1CCOCC1.CC(C)(C)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H18O2S.C9H18O.C8H16O/c1-9(2,3)8-4-6-12(10,11)7-5-8;1-9(2,3)8-4-6-10-7-5-8;1-8(2,3)7-4-5-9-6-7/h8H,4-7H2,1-3H3;8H,4-7H2,1-3H3;7H,4-6H2,1-3H3 |
| InChIKey | KRJDFNIIKOTUAG-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.77 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |