C18H36O3S — CID 157062529
4-tert-butyloxane;4-tert-butylthiane 1,1-dioxide (PubChem CID 157062529) has the molecular formula C18H36O3S and a molecular weight of 332.55 g/mol. Its IUPAC name is 4-tert-butyloxane;4-tert-butylthiane 1,1-dioxide.
| Compound Name | 4-tert-butyloxane;4-tert-butylthiane 1,1-dioxide |
|---|---|
| PubChem CID | 157062529 |
| Molecular Formula | C18H36O3S |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 4-tert-butyloxane;4-tert-butylthiane 1,1-dioxide |
| SMILES | CC(C)(C)C1CCOCC1.CC(C)(C)C1CCS(=O)(=O)CC1 |
| InChI | InChI=1S/C9H18O2S.C9H18O/c1-9(2,3)8-4-6-12(10,11)7-5-8;1-9(2,3)8-4-6-10-7-5-8/h8H,4-7H2,1-3H3;8H,4-7H2,1-3H3 |
| InChIKey | ABMMBBOBQNLSAG-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |