C24H54O3S — CID 157169486
1-methoxy-2,3,3-trimethylbutane;2,3,3-trimethyl-1-methylsulfonylbutane;2,2,3-trimethylpentane (PubChem CID 157169486) has the molecular formula C24H54O3S and a molecular weight of 422.76 g/mol. Its IUPAC name is 1-methoxy-2,3,3-trimethylbutane;2,3,3-trimethyl-1-methylsulfonylbutane;2,2,3-trimethylpentane.
| Compound Name | 1-methoxy-2,3,3-trimethylbutane;2,3,3-trimethyl-1-methylsulfonylbutane;2,2,3-trimethylpentane |
|---|---|
| PubChem CID | 157169486 |
| Molecular Formula | C24H54O3S |
| Molecular Weight | 422.76 g/mol |
| Exact Mass | 422.38 |
| IUPAC Name | 1-methoxy-2,3,3-trimethylbutane;2,3,3-trimethyl-1-methylsulfonylbutane;2,2,3-trimethylpentane |
| SMILES | CC(CS(C)(=O)=O)C(C)(C)C.CCC(C)C(C)(C)C.COCC(C)C(C)(C)C |
| InChI | InChI=1S/C8H18O2S.C8H18O.C8H18/c1-7(8(2,3)4)6-11(5,9)10;1-7(6-9-5)8(2,3)4;1-6-7(2)8(3,4)5/h7H,6H2,1-5H3;7H,6H2,1-5H3;7H,6H2,1-5H3 |
| InChIKey | ANHHUMCHBYAQKX-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.76 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |