C17H34O3S — CID 158534059
[(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutan-2-yl]cyclopropane (PubChem CID 158534059) has the molecular formula C17H34O3S and a molecular weight of 318.52 g/mol. Its IUPAC name is [(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutan-2-yl]cyclopropane.
| Compound Name | [(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutan-2-yl]cyclopropane |
|---|---|
| PubChem CID | 158534059 |
| Molecular Formula | C17H34O3S |
| Molecular Weight | 318.52 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | [(2R)-1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-3,3-dimethylbutan-2-yl]cyclopropane |
| SMILES | CC(C)(C)COCCCS(=O)(=O)C[C@H](C1CC1)C(C)(C)C |
| InChI | InChI=1S/C17H34O3S/c1-16(2,3)13-20-10-7-11-21(18,19)12-15(14-8-9-14)17(4,5)6/h14-15H,7-13H2,1-6H3/t15-/m1/s1 |
| InChIKey | OLHMPLVFLOOVJR-OAHLLOKOSA-N |
| XLogP | 3.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|