C16H32O3S — CID 158552808
1-(tert-butylsulfonylmethyl)-1-[3-(2,2-dimethylpropoxy)propyl]cyclopropane (PubChem CID 158552808) has the molecular formula C16H32O3S and a molecular weight of 304.50 g/mol. Its IUPAC name is 1-(tert-butylsulfonylmethyl)-1-[3-(2,2-dimethylpropoxy)propyl]cyclopropane.
| Compound Name | 1-(tert-butylsulfonylmethyl)-1-[3-(2,2-dimethylpropoxy)propyl]cyclopropane |
|---|---|
| PubChem CID | 158552808 |
| Molecular Formula | C16H32O3S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.21 |
| IUPAC Name | 1-(tert-butylsulfonylmethyl)-1-[3-(2,2-dimethylpropoxy)propyl]cyclopropane |
| SMILES | CC(C)(C)COCCCC1(CS(=O)(=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H32O3S/c1-14(2,3)12-19-11-7-8-16(9-10-16)13-20(17,18)15(4,5)6/h7-13H2,1-6H3 |
| InChIKey | UYDWNIOLEUWOSW-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|