C18H38O3S — CID 158872263
3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-3-ethyl-2,2-dimethylpentane (PubChem CID 158872263) has the molecular formula C18H38O3S and a molecular weight of 334.57 g/mol. Its IUPAC name is 3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-3-ethyl-2,2-dimethylpentane.
| Compound Name | 3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-3-ethyl-2,2-dimethylpentane |
|---|---|
| PubChem CID | 158872263 |
| Molecular Formula | C18H38O3S |
| Molecular Weight | 334.57 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | 3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-3-ethyl-2,2-dimethylpentane |
| SMILES | CCC(CC)(CS(=O)(=O)CCCOCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H38O3S/c1-9-18(10-2,17(6,7)8)15-22(19,20)13-11-12-21-14-16(3,4)5/h9-15H2,1-8H3 |
| InChIKey | KIKYELISPUPWOQ-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|