C18H38O2S — CID 141263751
2,2,3,3-tetramethyl-4-(3,3,4,4-tetramethylpentan-2-ylsulfonyl)pentane (PubChem CID 141263751) has the molecular formula C18H38O2S and a molecular weight of 318.57 g/mol. Its IUPAC name is 2,2,3,3-tetramethyl-4-(3,3,4,4-tetramethylpentan-2-ylsulfonyl)pentane.
| Compound Name | 2,2,3,3-tetramethyl-4-(3,3,4,4-tetramethylpentan-2-ylsulfonyl)pentane |
|---|---|
| PubChem CID | 141263751 |
| Molecular Formula | C18H38O2S |
| Molecular Weight | 318.57 g/mol |
| Exact Mass | 318.26 |
| IUPAC Name | 2,2,3,3-tetramethyl-4-(3,3,4,4-tetramethylpentan-2-ylsulfonyl)pentane |
| SMILES | CC(C(C)(C)C(C)(C)C)S(=O)(=O)C(C)C(C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H38O2S/c1-13(17(9,10)15(3,4)5)21(19,20)14(2)18(11,12)16(6,7)8/h13-14H,1-12H3 |
| InChIKey | YUEGXZHPVZCAFZ-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.57 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |