C16H34O3S — CID 157472516
1-tert-butylsulfonyl-5-(2,2-dimethylpropoxy)-2,2-dimethylpentane (PubChem CID 157472516) has the molecular formula C16H34O3S and a molecular weight of 306.51 g/mol. Its IUPAC name is 1-tert-butylsulfonyl-5-(2,2-dimethylpropoxy)-2,2-dimethylpentane.
| Compound Name | 1-tert-butylsulfonyl-5-(2,2-dimethylpropoxy)-2,2-dimethylpentane |
|---|---|
| PubChem CID | 157472516 |
| Molecular Formula | C16H34O3S |
| Molecular Weight | 306.51 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-tert-butylsulfonyl-5-(2,2-dimethylpropoxy)-2,2-dimethylpentane |
| SMILES | CC(C)(C)COCCCC(C)(C)CS(=O)(=O)C(C)(C)C |
| InChI | InChI=1S/C16H34O3S/c1-14(2,3)12-19-11-9-10-16(7,8)13-20(17,18)15(4,5)6/h9-13H2,1-8H3 |
| InChIKey | RZUKWEHNNGVXAC-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.51 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|