C18H36O3S — CID 157266587
1-tert-butyl-1-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]cyclopentane (PubChem CID 157266587) has the molecular formula C18H36O3S and a molecular weight of 332.55 g/mol. Its IUPAC name is 1-tert-butyl-1-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]cyclopentane.
| Compound Name | 1-tert-butyl-1-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]cyclopentane |
|---|---|
| PubChem CID | 157266587 |
| Molecular Formula | C18H36O3S |
| Molecular Weight | 332.55 g/mol |
| Exact Mass | 332.24 |
| IUPAC Name | 1-tert-butyl-1-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]cyclopentane |
| SMILES | CC(C)(C)COCCCS(=O)(=O)CC1(C(C)(C)C)CCCC1 |
| InChI | InChI=1S/C18H36O3S/c1-16(2,3)14-21-12-9-13-22(19,20)15-18(17(4,5)6)10-7-8-11-18/h7-15H2,1-6H3 |
| InChIKey | UBJDPZMRRUGTOU-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|