C16H34O3S — CID 158851342
(3R)-3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-2,2-dimethylpentane (PubChem CID 158851342) has the molecular formula C16H34O3S and a molecular weight of 306.51 g/mol. Its IUPAC name is (3R)-3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-2,2-dimethylpentane.
| Compound Name | (3R)-3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-2,2-dimethylpentane |
|---|---|
| PubChem CID | 158851342 |
| Molecular Formula | C16H34O3S |
| Molecular Weight | 306.51 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (3R)-3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-2,2-dimethylpentane |
| SMILES | CC[C@@H](CS(=O)(=O)CCCOCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H34O3S/c1-8-14(16(5,6)7)12-20(17,18)11-9-10-19-13-15(2,3)4/h14H,8-13H2,1-7H3/t14-/m0/s1 |
| InChIKey | QCHUGFAYZOPBKE-AWEZNQCLSA-N |
| XLogP | 3.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|