C17H36O3S — CID 158872260
(3R)-3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-2,2,4-trimethylpentane (PubChem CID 158872260) has the molecular formula C17H36O3S and a molecular weight of 320.54 g/mol. Its IUPAC name is (3R)-3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-2,2,4-trimethylpentane.
| Compound Name | (3R)-3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-2,2,4-trimethylpentane |
|---|---|
| PubChem CID | 158872260 |
| Molecular Formula | C17H36O3S |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | (3R)-3-[3-(2,2-dimethylpropoxy)propylsulfonylmethyl]-2,2,4-trimethylpentane |
| SMILES | CC(C)[C@@H](CS(=O)(=O)CCCOCC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C17H36O3S/c1-14(2)15(17(6,7)8)12-21(18,19)11-9-10-20-13-16(3,4)5/h14-15H,9-13H2,1-8H3/t15-/m1/s1 |
| InChIKey | KOLMTRFDOWAPSH-OAHLLOKOSA-N |
| XLogP | 4.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|