C15H32O3S — CID 158808119
5-(2,2-dimethylpropoxy)-2,2-dimethyl-1-propan-2-ylsulfonylpentane (PubChem CID 158808119) has the molecular formula C15H32O3S and a molecular weight of 292.49 g/mol. Its IUPAC name is 5-(2,2-dimethylpropoxy)-2,2-dimethyl-1-propan-2-ylsulfonylpentane.
| Compound Name | 5-(2,2-dimethylpropoxy)-2,2-dimethyl-1-propan-2-ylsulfonylpentane |
|---|---|
| PubChem CID | 158808119 |
| Molecular Formula | C15H32O3S |
| Molecular Weight | 292.49 g/mol |
| Exact Mass | 292.21 |
| IUPAC Name | 5-(2,2-dimethylpropoxy)-2,2-dimethyl-1-propan-2-ylsulfonylpentane |
| SMILES | CC(C)S(=O)(=O)CC(C)(C)CCCOCC(C)(C)C |
| InChI | InChI=1S/C15H32O3S/c1-13(2)19(16,17)12-15(6,7)9-8-10-18-11-14(3,4)5/h13H,8-12H2,1-7H3 |
| InChIKey | DERLGGYWFLACSH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|