C16H34O3S — CID 158851343
1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2,2,3,3-tetramethylbutane (PubChem CID 158851343) has the molecular formula C16H34O3S and a molecular weight of 306.51 g/mol. Its IUPAC name is 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2,2,3,3-tetramethylbutane.
| Compound Name | 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2,2,3,3-tetramethylbutane |
|---|---|
| PubChem CID | 158851343 |
| Molecular Formula | C16H34O3S |
| Molecular Weight | 306.51 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 1-[3-(2,2-dimethylpropoxy)propylsulfonyl]-2,2,3,3-tetramethylbutane |
| SMILES | CC(C)(C)COCCCS(=O)(=O)CC(C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H34O3S/c1-14(2,3)12-19-10-9-11-20(17,18)13-16(7,8)15(4,5)6/h9-13H2,1-8H3 |
| InChIKey | YGIWGYBIPSZJJM-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.51 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|